C31H45N5O4 — CID 122177641
4-[3-(1-butyltriazol-4-yl)propoxy]-N-[4-[[(3R)-6-ethynyl-3,4-dihydro-2H-pyran-3-yl]-propylamino]butyl]-3-methoxybenzamide (PubChem CID 122177641) has the molecular formula C31H45N5O4 and a molecular weight of 551.73 g/mol. Its IUPAC name is 4-[3-(1-butyltriazol-4-yl)propoxy]-N-[4-[[(3R)-6-ethynyl-3,4-dihydro-2H-pyran-3-yl]-propylamino]butyl]-3-methoxybenzamide.
| Compound Name | 4-[3-(1-butyltriazol-4-yl)propoxy]-N-[4-[[(3R)-6-ethynyl-3,4-dihydro-2H-pyran-3-yl]-propylamino]butyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 122177641 |
| Molecular Formula | C31H45N5O4 |
| Molecular Weight | 551.73 g/mol |
| Exact Mass | 551.35 |
| IUPAC Name | 4-[3-(1-butyltriazol-4-yl)propoxy]-N-[4-[[(3R)-6-ethynyl-3,4-dihydro-2H-pyran-3-yl]-propylamino]butyl]-3-methoxybenzamide |
| SMILES | C#CC1=CC[C@@H](N(CCC)CCCCNC(=O)c2ccc(OCCCc3cn(CCCC)nn3)c(OC)c2)CO1 |
| InChI | InChI=1S/C31H45N5O4/c1-5-8-20-36-23-26(33-34-36)12-11-21-39-29-16-13-25(22-30(29)38-4)31(37)32-17-9-10-19-35(18-6-2)27-14-15-28(7-3)40-24-27/h3,13,15-16,22-23,27H,5-6,8-12,14,17-21,24H2,1-2,4H3,(H,32,37)/t27-/m1/s1 |
| InChIKey | XPMUUENUQYZASR-HHHXNRCGSA-N |
| XLogP | 4.63 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.73 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|