C26H40O8 — CID 122177650
(1S,2R,5R,6S,10R,13S,14S,16S,17R,20S,21S,22R)-14-methoxy-2,5-dimethyl-8-propan-2-yl-15,19,23-trioxahexacyclo[18.2.1.02,10.05,9.013,22.016,21]tricos-8-ene-6,16,17,21-tetrol (PubChem CID 122177650) has the molecular formula C26H40O8 and a molecular weight of 480.60 g/mol. Its IUPAC name is (1S,2R,5R,6S,10R,13S,14S,16S,17R,20S,21S,22R)-14-methoxy-2,5-dimethyl-8-propan-2-yl-15,19,23-trioxahexacyclo[18.2.1.02,10.05,9.013,22.016,21]tricos-8-ene-6,16,17,21-tetrol.
| Compound Name | (1S,2R,5R,6S,10R,13S,14S,16S,17R,20S,21S,22R)-14-methoxy-2,5-dimethyl-8-propan-2-yl-15,19,23-trioxahexacyclo[18.2.1.02,10.05,9.013,22.016,21]tricos-8-ene-6,16,17,21-tetrol |
|---|---|
| PubChem CID | 122177650 |
| Molecular Formula | C26H40O8 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | (1S,2R,5R,6S,10R,13S,14S,16S,17R,20S,21S,22R)-14-methoxy-2,5-dimethyl-8-propan-2-yl-15,19,23-trioxahexacyclo[18.2.1.02,10.05,9.013,22.016,21]tricos-8-ene-6,16,17,21-tetrol |
| SMILES | CO[C@H]1O[C@@]2(O)[C@H](O)CO[C@H]3O[C@H]4[C@@H]([C@@H]1CC[C@@H]1C5=C(C(C)C)C[C@H](O)[C@]5(C)CC[C@]14C)[C@]32O |
| InChI | InChI=1S/C26H40O8/c1-12(2)14-10-16(27)24(4)9-8-23(3)15(18(14)24)7-6-13-19-20(23)33-22-25(19,29)26(30,17(28)11-32-22)34-21(13)31-5/h12-13,15-17,19-22,27-30H,6-11H2,1-5H3/t13-,15+,16-,17+,19+,20-,21-,22-,23+,24-,25-,26-/m0/s1 |
| InChIKey | JYWNCDPDOPIRTK-JSPUZNANSA-N |
| XLogP | 1.69 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|