C26H46N6O4 — CID 122177737
(2S)-2-[[(2R)-3-cyclohexyl-1-oxo-1-[(4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]propan-2-yl]carbamoylamino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 122177737) has the molecular formula C26H46N6O4 and a molecular weight of 506.69 g/mol. Its IUPAC name is (2S)-2-[[(2R)-3-cyclohexyl-1-oxo-1-[(4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]propan-2-yl]carbamoylamino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[[(2R)-3-cyclohexyl-1-oxo-1-[(4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]propan-2-yl]carbamoylamino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 122177737 |
| Molecular Formula | C26H46N6O4 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.36 |
| IUPAC Name | (2S)-2-[[(2R)-3-cyclohexyl-1-oxo-1-[(4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]propan-2-yl]carbamoylamino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC12CCC(C(NC(=O)[C@@H](CC3CCCCC3)NC(=O)N[C@@H](CCCN=C(N)N)C(=O)O)C1)C2(C)C |
| InChI | InChI=1S/C26H46N6O4/c1-25(2)17-11-12-26(25,3)15-20(17)30-21(33)19(14-16-8-5-4-6-9-16)32-24(36)31-18(22(34)35)10-7-13-29-23(27)28/h16-20H,4-15H2,1-3H3,(H,30,33)(H,34,35)(H4,27,28,29)(H2,31,32,36)/t17?,18-,19+,20?,26?/m0/s1 |
| InChIKey | FRONFJPZPPGYAX-WKCFZQPLSA-N |
| XLogP | 2.46 |
| TPSA | 171.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|