C25H46O7 — CID 122177898
(1R,3R,6R,7S,8S,9R,10R,12R,13S,17S)-3-ethyl-7,9,10-trihydroxy-2,2,6,8,10,12,15,15,17-nonamethyl-4,14,16-trioxabicyclo[11.3.1]heptadecan-5-one (PubChem CID 122177898) has the molecular formula C25H46O7 and a molecular weight of 458.64 g/mol. Its IUPAC name is (1R,3R,6R,7S,8S,9R,10R,12R,13S,17S)-3-ethyl-7,9,10-trihydroxy-2,2,6,8,10,12,15,15,17-nonamethyl-4,14,16-trioxabicyclo[11.3.1]heptadecan-5-one.
| Compound Name | (1R,3R,6R,7S,8S,9R,10R,12R,13S,17S)-3-ethyl-7,9,10-trihydroxy-2,2,6,8,10,12,15,15,17-nonamethyl-4,14,16-trioxabicyclo[11.3.1]heptadecan-5-one |
|---|---|
| PubChem CID | 122177898 |
| Molecular Formula | C25H46O7 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.32 |
| IUPAC Name | (1R,3R,6R,7S,8S,9R,10R,12R,13S,17S)-3-ethyl-7,9,10-trihydroxy-2,2,6,8,10,12,15,15,17-nonamethyl-4,14,16-trioxabicyclo[11.3.1]heptadecan-5-one |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](O)[C@H](C)[C@@H](O)[C@](C)(O)C[C@@H](C)[C@@H]2OC(C)(C)O[C@H]([C@H]2C)C1(C)C |
| InChI | InChI=1S/C25H46O7/c1-11-17-23(6,7)21-16(5)19(31-24(8,9)32-21)13(2)12-25(10,29)20(27)14(3)18(26)15(4)22(28)30-17/h13-21,26-27,29H,11-12H2,1-10H3/t13-,14+,15-,16+,17-,18+,19+,20-,21-,25-/m1/s1 |
| InChIKey | AEURGPDCLXVPFL-BFKAXXEZSA-N |
| XLogP | 3.28 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |