C24H26N2O6 — CID 122177942
methyl (5S,10bR)-5-(hydroxymethyl)-10b-methyl-2-(2-nitro-1-phenylethyl)-3-oxo-5,6-dihydro-1H-pyrrolo[2,1-a]isoquinoline-2-carboxylate (PubChem CID 122177942) has the molecular formula C24H26N2O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is methyl (5S,10bR)-5-(hydroxymethyl)-10b-methyl-2-(2-nitro-1-phenylethyl)-3-oxo-5,6-dihydro-1H-pyrrolo[2,1-a]isoquinoline-2-carboxylate.
| Compound Name | methyl (5S,10bR)-5-(hydroxymethyl)-10b-methyl-2-(2-nitro-1-phenylethyl)-3-oxo-5,6-dihydro-1H-pyrrolo[2,1-a]isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 122177942 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | methyl (5S,10bR)-5-(hydroxymethyl)-10b-methyl-2-(2-nitro-1-phenylethyl)-3-oxo-5,6-dihydro-1H-pyrrolo[2,1-a]isoquinoline-2-carboxylate |
| SMILES | COC(=O)C1(C(C[N+](=O)[O-])c2ccccc2)C[C@]2(C)c3ccccc3C[C@@H](CO)N2C1=O |
| InChI | InChI=1S/C24H26N2O6/c1-23-15-24(22(29)32-2,20(13-25(30)31)16-8-4-3-5-9-16)21(28)26(23)18(14-27)12-17-10-6-7-11-19(17)23/h3-11,18,20,27H,12-15H2,1-2H3/t18-,20?,23+,24?/m0/s1 |
| InChIKey | SSDLHBSHMPPCEQ-AQALDHDDSA-N |
| XLogP | 2.27 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|