C23H24N2O3 — CID 122177946
(2S,5S,10bR)-5-(hydroxymethyl)-10b-methyl-4'-phenylspiro[5,6-dihydro-1H-pyrrolo[2,1-a]isoquinoline-2,3'-pyrrolidine]-2',3-dione (PubChem CID 122177946) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is (2S,5S,10bR)-5-(hydroxymethyl)-10b-methyl-4'-phenylspiro[5,6-dihydro-1H-pyrrolo[2,1-a]isoquinoline-2,3'-pyrrolidine]-2',3-dione.
| Compound Name | (2S,5S,10bR)-5-(hydroxymethyl)-10b-methyl-4'-phenylspiro[5,6-dihydro-1H-pyrrolo[2,1-a]isoquinoline-2,3'-pyrrolidine]-2',3-dione |
|---|---|
| PubChem CID | 122177946 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | (2S,5S,10bR)-5-(hydroxymethyl)-10b-methyl-4'-phenylspiro[5,6-dihydro-1H-pyrrolo[2,1-a]isoquinoline-2,3'-pyrrolidine]-2',3-dione |
| SMILES | C[C@]12C[C@]3(C(=O)NCC3c3ccccc3)C(=O)N1[C@H](CO)Cc1ccccc12 |
| InChI | InChI=1S/C23H24N2O3/c1-22-14-23(19(12-24-20(23)27)15-7-3-2-4-8-15)21(28)25(22)17(13-26)11-16-9-5-6-10-18(16)22/h2-10,17,19,26H,11-14H2,1H3,(H,24,27)/t17-,19?,22+,23-/m0/s1 |
| InChIKey | YZMQBRLXGMQICR-KWRUJKLMSA-N |
| XLogP | 1.95 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|