C27H30O4 — CID 122178019
benzyl (1S,4aS,10aR)-1,4a-dimethyl-6-prop-2-enoyloxy-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate (PubChem CID 122178019) has the molecular formula C27H30O4 and a molecular weight of 418.53 g/mol. Its IUPAC name is benzyl (1S,4aS,10aR)-1,4a-dimethyl-6-prop-2-enoyloxy-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate.
| Compound Name | benzyl (1S,4aS,10aR)-1,4a-dimethyl-6-prop-2-enoyloxy-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 122178019 |
| Molecular Formula | C27H30O4 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | benzyl (1S,4aS,10aR)-1,4a-dimethyl-6-prop-2-enoyloxy-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
| SMILES | C=CC(=O)Oc1ccc2c(c1)[C@@]1(C)CCC[C@](C)(C(=O)OCc3ccccc3)[C@@H]1CC2 |
| InChI | InChI=1S/C27H30O4/c1-4-24(28)31-21-13-11-20-12-14-23-26(2,22(20)17-21)15-8-16-27(23,3)25(29)30-18-19-9-6-5-7-10-19/h4-7,9-11,13,17,23H,1,8,12,14-16,18H2,2-3H3/t23-,26-,27+/m1/s1 |
| InChIKey | SPPQKNONBZLBKX-MVNQZMKCSA-N |
| XLogP | 5.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|