C22H30O4 — CID 122178030
methyl (1S,4aS,10aR)-1,4a-dimethyl-6-(2-methylpropanoyloxy)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate (PubChem CID 122178030) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is methyl (1S,4aS,10aR)-1,4a-dimethyl-6-(2-methylpropanoyloxy)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate.
| Compound Name | methyl (1S,4aS,10aR)-1,4a-dimethyl-6-(2-methylpropanoyloxy)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 122178030 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | methyl (1S,4aS,10aR)-1,4a-dimethyl-6-(2-methylpropanoyloxy)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CCC[C@]2(C)c3cc(OC(=O)C(C)C)ccc3CC[C@@H]12 |
| InChI | InChI=1S/C22H30O4/c1-14(2)19(23)26-16-9-7-15-8-10-18-21(3,17(15)13-16)11-6-12-22(18,4)20(24)25-5/h7,9,13-14,18H,6,8,10-12H2,1-5H3/t18-,21-,22+/m1/s1 |
| InChIKey | MPNBIHVLCWBLTB-QIJUGHKUSA-N |
| XLogP | 4.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|