C21H27FO4 — CID 122178032
methyl (1S,4aS,10aR)-6-(2-fluoropropanoyloxy)-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate (PubChem CID 122178032) has the molecular formula C21H27FO4 and a molecular weight of 362.44 g/mol. Its IUPAC name is methyl (1S,4aS,10aR)-6-(2-fluoropropanoyloxy)-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate.
| Compound Name | methyl (1S,4aS,10aR)-6-(2-fluoropropanoyloxy)-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 122178032 |
| Molecular Formula | C21H27FO4 |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | methyl (1S,4aS,10aR)-6-(2-fluoropropanoyloxy)-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CCC[C@]2(C)c3cc(OC(=O)C(C)F)ccc3CC[C@@H]12 |
| InChI | InChI=1S/C21H27FO4/c1-13(22)18(23)26-15-8-6-14-7-9-17-20(2,16(14)12-15)10-5-11-21(17,3)19(24)25-4/h6,8,12-13,17H,5,7,9-11H2,1-4H3/t13?,17-,20-,21+/m1/s1 |
| InChIKey | QUCVTZNYLGBOIH-HTOZYHRKSA-N |
| XLogP | 4.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|