About 3-[[[(1R)-1-(2,4-difluorophenyl)ethyl]-(quinoline-3-carbonyl)amino]methyl]benzoic acid
3-[[[(1R)-1-(2,4-difluorophenyl)ethyl]-(quinoline-3-carbonyl)amino]methyl]benzoic acid (PubChem CID 122178104) has the molecular formula C26H20F2N2O3
and a molecular weight of 446.45 g/mol. Its IUPAC name is 3-[[[(1R)-1-(2,4-difluorophenyl)ethyl]-(quinoline-3-carbonyl)amino]methyl]benzoic acid.
Molecular Properties
| Compound Name | 3-[[[(1R)-1-(2,4-difluorophenyl)ethyl]-(quinoline-3-carbonyl)amino]methyl]benzoic acid |
| PubChem CID | 122178104 |
| Molecular Formula | C26H20F2N2O3 |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 3-[[[(1R)-1-(2,4-difluorophenyl)ethyl]-(quinoline-3-carbonyl)amino]methyl]benzoic acid |
| SMILES | C[C@H](c1ccc(F)cc1F)N(Cc1cccc(C(=O)O)c1)C(=O)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C26H20F2N2O3/c1-16(22-10-9-21(27)13-23(22)28)30(15-17-5-4-7-19(11-17)26(32)33)25(31)20-12-18-6-2-3-8-24(18)29-14-20/h2-14,16H,15H2,1H3,(H,32,33)/t16-/m1/s1 |
| InChIKey | BIJFFIYUDTYIPE-MRXNPFEDSA-N |
| XLogP | 5.61 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[[(1R)-1-(2,4-difluorophenyl)ethyl]-(quinoline-3-carbonyl)amino]methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[[(1R)-1-(2,4-difluorophenyl)ethyl]-(quinoline-3-carbonyl)amino]methyl]benzoic acid?
The IUPAC name of 3-[[[(1R)-1-(2,4-difluorophenyl)ethyl]-(quinoline-3-carbonyl)amino]methyl]benzoic acid (CID 122178104) is 3-[[[(1R)-1-(2,4-difluorophenyl)ethyl]-(quinoline-3-carbonyl)amino]methyl]benzoic acid.
What is the SMILES notation for 3-[[[(1R)-1-(2,4-difluorophenyl)ethyl]-(quinoline-3-carbonyl)amino]methyl]benzoic acid?
The canonical SMILES for 3-[[[(1R)-1-(2,4-difluorophenyl)ethyl]-(quinoline-3-carbonyl)amino]methyl]benzoic acid is C[C@H](c1ccc(F)cc1F)N(Cc1cccc(C(=O)O)c1)C(=O)c1cnc2ccccc2c1.
What is the InChIKey of 3-[[[(1R)-1-(2,4-difluorophenyl)ethyl]-(quinoline-3-carbonyl)amino]methyl]benzoic acid?
The InChIKey is BIJFFIYUDTYIPE-MRXNPFEDSA-N. The full InChI is InChI=1S/C26H20F2N2O3/c1-16(22-10-9-21(27)13-23(22)28)30(15-17-5-4-7-19(11-17)26(32)33)25(31)20-12-18-6-2-3-8-24(18)29-14-20/h2-14,16H,15H2,1H3,(H,32,33)/t16-/m1/s1.
What are the key properties of 3-[[[(1R)-1-(2,4-difluorophenyl)ethyl]-(quinoline-3-carbonyl)amino]methyl]benzoic acid?
3-[[[(1R)-1-(2,4-difluorophenyl)ethyl]-(quinoline-3-carbonyl)amino]methyl]benzoic acid has a molecular weight of 446.45 g/mol, XLogP of 5.61, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[[(1R)-1-(2,4-difluorophenyl)ethyl]-(quinoline-3-carbonyl)amino]methyl]benzoic acid is sourced from PubChem (CID 122178104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).