C25H23N3O5 — CID 122178220
N-[(2S,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]anthracene-9-carboxamide (PubChem CID 122178220) has the molecular formula C25H23N3O5 and a molecular weight of 445.48 g/mol. Its IUPAC name is N-[(2S,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]anthracene-9-carboxamide.
| Compound Name | N-[(2S,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]anthracene-9-carboxamide |
|---|---|
| PubChem CID | 122178220 |
| Molecular Formula | C25H23N3O5 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | N-[(2S,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]anthracene-9-carboxamide |
| SMILES | Cc1cn([C@H]2C[C@H](NC(=O)c3c4ccccc4cc4ccccc34)[C@@H](CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C25H23N3O5/c1-14-12-28(25(32)27-23(14)30)21-11-19(20(13-29)33-21)26-24(31)22-17-8-4-2-6-15(17)10-16-7-3-5-9-18(16)22/h2-10,12,19-21,29H,11,13H2,1H3,(H,26,31)(H,27,30,32)/t19-,20+,21+/m0/s1 |
| InChIKey | ABOGAJDPVPYUGH-PWRODBHTSA-N |
| XLogP | 2.23 |
| TPSA | 113.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|