About 6-ethoxy-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine
6-ethoxy-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine (PubChem CID 122178336) has the molecular formula C18H17N3O
and a molecular weight of 291.35 g/mol. Its IUPAC name is 6-ethoxy-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine.
Molecular Properties
| Compound Name | 6-ethoxy-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine |
| PubChem CID | 122178336 |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 6-ethoxy-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine |
| SMILES | CCOc1ccc2c(c1)Cc1c(Nc3ccccc3)n[nH]c1-2 |
| InChI | InChI=1S/C18H17N3O/c1-2-22-14-8-9-15-12(10-14)11-16-17(15)20-21-18(16)19-13-6-4-3-5-7-13/h3-10H,2,11H2,1H3,(H2,19,20,21) |
| InChIKey | VEISJGFOSMXIJY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-ethoxy-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxy-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine?
The IUPAC name of 6-ethoxy-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine (CID 122178336) is 6-ethoxy-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine.
What is the SMILES notation for 6-ethoxy-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine?
The canonical SMILES for 6-ethoxy-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine is CCOc1ccc2c(c1)Cc1c(Nc3ccccc3)n[nH]c1-2.
What is the InChIKey of 6-ethoxy-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine?
The InChIKey is VEISJGFOSMXIJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O/c1-2-22-14-8-9-15-12(10-14)11-16-17(15)20-21-18(16)19-13-6-4-3-5-7-13/h3-10H,2,11H2,1H3,(H2,19,20,21).
What are the key properties of 6-ethoxy-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine?
6-ethoxy-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine has a molecular weight of 291.35 g/mol, XLogP of 4.12, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine is sourced from PubChem (CID 122178336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).