About (3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-3-[(2-methoxyphenyl)methyl]oxolan-2-one
(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-3-[(2-methoxyphenyl)methyl]oxolan-2-one (PubChem CID 122178350) has the molecular formula C21H24O5
and a molecular weight of 356.42 g/mol. Its IUPAC name is (3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-3-[(2-methoxyphenyl)methyl]oxolan-2-one.
Molecular Properties
| Compound Name | (3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-3-[(2-methoxyphenyl)methyl]oxolan-2-one |
| PubChem CID | 122178350 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-3-[(2-methoxyphenyl)methyl]oxolan-2-one |
| SMILES | COc1ccccc1C[C@H]1C(=O)OC[C@@H]1Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C21H24O5/c1-23-18-7-5-4-6-15(18)12-17-16(13-26-21(17)22)10-14-8-9-19(24-2)20(11-14)25-3/h4-9,11,16-17H,10,12-13H2,1-3H3/t16-,17+/m0/s1 |
| InChIKey | JFKPJJUJGFTDSA-DLBZAZTESA-N |
| XLogP | 3.29 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-3-[(2-methoxyphenyl)methyl]oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-3-[(2-methoxyphenyl)methyl]oxolan-2-one?
The IUPAC name of (3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-3-[(2-methoxyphenyl)methyl]oxolan-2-one (CID 122178350) is (3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-3-[(2-methoxyphenyl)methyl]oxolan-2-one.
What is the SMILES notation for (3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-3-[(2-methoxyphenyl)methyl]oxolan-2-one?
The canonical SMILES for (3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-3-[(2-methoxyphenyl)methyl]oxolan-2-one is COc1ccccc1C[C@H]1C(=O)OC[C@@H]1Cc1ccc(OC)c(OC)c1.
What is the InChIKey of (3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-3-[(2-methoxyphenyl)methyl]oxolan-2-one?
The InChIKey is JFKPJJUJGFTDSA-DLBZAZTESA-N. The full InChI is InChI=1S/C21H24O5/c1-23-18-7-5-4-6-15(18)12-17-16(13-26-21(17)22)10-14-8-9-19(24-2)20(11-14)25-3/h4-9,11,16-17H,10,12-13H2,1-3H3/t16-,17+/m0/s1.
What are the key properties of (3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-3-[(2-methoxyphenyl)methyl]oxolan-2-one?
(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-3-[(2-methoxyphenyl)methyl]oxolan-2-one has a molecular weight of 356.42 g/mol, XLogP of 3.29, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-3-[(2-methoxyphenyl)methyl]oxolan-2-one is sourced from PubChem (CID 122178350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).