C24H17Cl2N3O3 — CID 122178484
(2S)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanamide (PubChem CID 122178484) has the molecular formula C24H17Cl2N3O3 and a molecular weight of 466.32 g/mol. Its IUPAC name is (2S)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanamide.
| Compound Name | (2S)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 122178484 |
| Molecular Formula | C24H17Cl2N3O3 |
| Molecular Weight | 466.32 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | (2S)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanamide |
| SMILES | O=C(N/N=C\c1ccc(Cl)c(Cl)c1)[C@H](Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H17Cl2N3O3/c25-19-11-10-16(12-20(19)26)14-27-28-22(30)21(13-15-6-2-1-3-7-15)29-23(31)17-8-4-5-9-18(17)24(29)32/h1-12,14,21H,13H2,(H,28,30)/b27-14-/t21-/m0/s1 |
| InChIKey | CEBMUYRZSMKNET-LXXZAFCOSA-N |
| XLogP | 4.35 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.32 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|