C45H66N6O6 — CID 122178495
5-[3-(2-acetamidoethyl)-5-methoxyindol-1-yl]-N-[9-[5-[3-(2-acetamidoethyl)-5-methoxyindol-1-yl]pentanoylamino]nonyl]pentanamide (PubChem CID 122178495) has the molecular formula C45H66N6O6 and a molecular weight of 787.06 g/mol. Its IUPAC name is 5-[3-(2-acetamidoethyl)-5-methoxyindol-1-yl]-N-[9-[5-[3-(2-acetamidoethyl)-5-methoxyindol-1-yl]pentanoylamino]nonyl]pentanamide.
| Compound Name | 5-[3-(2-acetamidoethyl)-5-methoxyindol-1-yl]-N-[9-[5-[3-(2-acetamidoethyl)-5-methoxyindol-1-yl]pentanoylamino]nonyl]pentanamide |
|---|---|
| PubChem CID | 122178495 |
| Molecular Formula | C45H66N6O6 |
| Molecular Weight | 787.06 g/mol |
| Exact Mass | 786.50 |
| IUPAC Name | 5-[3-(2-acetamidoethyl)-5-methoxyindol-1-yl]-N-[9-[5-[3-(2-acetamidoethyl)-5-methoxyindol-1-yl]pentanoylamino]nonyl]pentanamide |
| SMILES | COc1ccc2c(c1)c(CCNC(C)=O)cn2CCCCC(=O)NCCCCCCCCCNC(=O)CCCCn1cc(CCNC(C)=O)c2cc(OC)ccc21 |
| InChI | InChI=1S/C45H66N6O6/c1-34(52)46-26-22-36-32-50(42-20-18-38(56-3)30-40(36)42)28-14-10-16-44(54)48-24-12-8-6-5-7-9-13-25-49-45(55)17-11-15-29-51-33-37(23-27-47-35(2)53)41-31-39(57-4)19-21-43(41)51/h18-21,30-33H,5-17,22-29H2,1-4H3,(H,46,52)(H,47,53)(H,48,54)(H,49,55) |
| InChIKey | AQJRNARSFGQEMM-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 144.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.06 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|