C20H23NO6 — CID 122178622
3-[(3-amino-4-methoxyphenyl)methyl]-5,6,7-trimethoxy-2,3-dihydrochromen-4-one (PubChem CID 122178622) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is 3-[(3-amino-4-methoxyphenyl)methyl]-5,6,7-trimethoxy-2,3-dihydrochromen-4-one.
| Compound Name | 3-[(3-amino-4-methoxyphenyl)methyl]-5,6,7-trimethoxy-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 122178622 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 3-[(3-amino-4-methoxyphenyl)methyl]-5,6,7-trimethoxy-2,3-dihydrochromen-4-one |
| SMILES | COc1ccc(CC2COc3cc(OC)c(OC)c(OC)c3C2=O)cc1N |
| InChI | InChI=1S/C20H23NO6/c1-23-14-6-5-11(8-13(14)21)7-12-10-27-15-9-16(24-2)19(25-3)20(26-4)17(15)18(12)22/h5-6,8-9,12H,7,10,21H2,1-4H3 |
| InChIKey | ZGCVIOKBSBFQDN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|