C22H38O3 — CID 122178735
(2R)-2-[(Z,2R)-2-hydroxyheptadec-10-enyl]-2,3-dihydropyran-6-one (PubChem CID 122178735) has the molecular formula C22H38O3 and a molecular weight of 350.54 g/mol. Its IUPAC name is (2R)-2-[(Z,2R)-2-hydroxyheptadec-10-enyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(Z,2R)-2-hydroxyheptadec-10-enyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 122178735 |
| Molecular Formula | C22H38O3 |
| Molecular Weight | 350.54 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | (2R)-2-[(Z,2R)-2-hydroxyheptadec-10-enyl]-2,3-dihydropyran-6-one |
| SMILES | CCCCCC/C=C\CCCCCCC[C@@H](O)C[C@H]1CC=CC(=O)O1 |
| InChI | InChI=1S/C22H38O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-20(23)19-21-17-15-18-22(24)25-21/h7-8,15,18,20-21,23H,2-6,9-14,16-17,19H2,1H3/b8-7-/t20-,21-/m1/s1 |
| InChIKey | WJCMTFWRMNKUKV-LSORQBDOSA-N |
| XLogP | 5.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.54 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|