C24H42O4 — CID 122178738
(1S,5R)-7-[(Z)-2-hydroxyheptadec-8-enyl]-2,6-dioxabicyclo[3.3.1]nonan-3-one (PubChem CID 122178738) has the molecular formula C24H42O4 and a molecular weight of 394.60 g/mol. Its IUPAC name is (1S,5R)-7-[(Z)-2-hydroxyheptadec-8-enyl]-2,6-dioxabicyclo[3.3.1]nonan-3-one.
| Compound Name | (1S,5R)-7-[(Z)-2-hydroxyheptadec-8-enyl]-2,6-dioxabicyclo[3.3.1]nonan-3-one |
|---|---|
| PubChem CID | 122178738 |
| Molecular Formula | C24H42O4 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | (1S,5R)-7-[(Z)-2-hydroxyheptadec-8-enyl]-2,6-dioxabicyclo[3.3.1]nonan-3-one |
| SMILES | CCCCCCCC/C=C\CCCCCC(O)CC1C[C@H]2C[C@H](CC(=O)O2)O1 |
| InChI | InChI=1S/C24H42O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-20(25)16-21-17-22-18-23(27-21)19-24(26)28-22/h9-10,20-23,25H,2-8,11-19H2,1H3/b10-9-/t20?,21?,22-,23+/m0/s1 |
| InChIKey | DBPNVMLJLQNPAA-DBFLHBRJSA-N |
| XLogP | 5.86 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|