C33H40O5 — CID 122178822
[(5R,7R,8R,9R,10R,13S,17R)-4,4,8,10,13-pentamethyl-3-oxo-17-(5-oxo-2H-furan-3-yl)-1,2,5,6,7,9,11,12,16,17-decahydrocyclopenta[a]phenanthren-7-yl] benzoate (PubChem CID 122178822) has the molecular formula C33H40O5 and a molecular weight of 516.68 g/mol. Its IUPAC name is [(5R,7R,8R,9R,10R,13S,17R)-4,4,8,10,13-pentamethyl-3-oxo-17-(5-oxo-2H-furan-3-yl)-1,2,5,6,7,9,11,12,16,17-decahydrocyclopenta[a]phenanthren-7-yl] benzoate.
| Compound Name | [(5R,7R,8R,9R,10R,13S,17R)-4,4,8,10,13-pentamethyl-3-oxo-17-(5-oxo-2H-furan-3-yl)-1,2,5,6,7,9,11,12,16,17-decahydrocyclopenta[a]phenanthren-7-yl] benzoate |
|---|---|
| PubChem CID | 122178822 |
| Molecular Formula | C33H40O5 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | [(5R,7R,8R,9R,10R,13S,17R)-4,4,8,10,13-pentamethyl-3-oxo-17-(5-oxo-2H-furan-3-yl)-1,2,5,6,7,9,11,12,16,17-decahydrocyclopenta[a]phenanthren-7-yl] benzoate |
| SMILES | CC1(C)C(=O)CC[C@]2(C)[C@H]3CC[C@]4(C)C(=CC[C@H]4C4=CC(=O)OC4)[C@]3(C)[C@H](OC(=O)c3ccccc3)C[C@@H]12 |
| InChI | InChI=1S/C33H40O5/c1-30(2)25-18-27(38-29(36)20-9-7-6-8-10-20)33(5)23-12-11-22(21-17-28(35)37-19-21)31(23,3)15-13-24(33)32(25,4)16-14-26(30)34/h6-10,12,17,22,24-25,27H,11,13-16,18-19H2,1-5H3/t22-,24+,25-,27+,31-,32+,33-/m0/s1 |
| InChIKey | JVJYIUSSJCBVHK-SZDGHHOWSA-N |
| XLogP | 6.48 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|