About 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carbonitrile
5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carbonitrile (PubChem CID 122178900) has the molecular formula C12H8BN3O3
and a molecular weight of 253.03 g/mol. Its IUPAC name is 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carbonitrile.
Molecular Properties
| Compound Name | 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carbonitrile |
| PubChem CID | 122178900 |
| Molecular Formula | C12H8BN3O3 |
| Molecular Weight | 253.03 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carbonitrile |
| SMILES | N#Cc1cnc(Oc2ccc3c(c2)B(O)OC3)cn1 |
| InChI | InChI=1S/C12H8BN3O3/c14-4-9-5-16-12(6-15-9)19-10-2-1-8-7-18-13(17)11(8)3-10/h1-3,5-6,17H,7H2 |
| InChIKey | ZHYRWDLBRKJSGM-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.03 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carbonitrile?
The IUPAC name of 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carbonitrile (CID 122178900) is 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carbonitrile.
What is the SMILES notation for 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carbonitrile?
The canonical SMILES for 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carbonitrile is N#Cc1cnc(Oc2ccc3c(c2)B(O)OC3)cn1.
What is the InChIKey of 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carbonitrile?
The InChIKey is ZHYRWDLBRKJSGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8BN3O3/c14-4-9-5-16-12(6-15-9)19-10-2-1-8-7-18-13(17)11(8)3-10/h1-3,5-6,17H,7H2.
What are the key properties of 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carbonitrile?
5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carbonitrile has a molecular weight of 253.03 g/mol, XLogP of 0.36, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carbonitrile is sourced from PubChem (CID 122178900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).