About 2-methylpropyl 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carboxylate
2-methylpropyl 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carboxylate (PubChem CID 122178918) has the molecular formula C16H17BN2O5
and a molecular weight of 328.13 g/mol. Its IUPAC name is 2-methylpropyl 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | 2-methylpropyl 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carboxylate |
| PubChem CID | 122178918 |
| Molecular Formula | C16H17BN2O5 |
| Molecular Weight | 328.13 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2-methylpropyl 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carboxylate |
| SMILES | CC(C)COC(=O)c1cnc(Oc2ccc3c(c2)B(O)OC3)cn1 |
| InChI | InChI=1S/C16H17BN2O5/c1-10(2)8-22-16(20)14-6-19-15(7-18-14)24-12-4-3-11-9-23-17(21)13(11)5-12/h3-7,10,21H,8-9H2,1-2H3 |
| InChIKey | OGIIEMDRGWOAOJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 90.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.13 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carboxylate?
The IUPAC name of 2-methylpropyl 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carboxylate (CID 122178918) is 2-methylpropyl 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carboxylate.
What is the SMILES notation for 2-methylpropyl 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carboxylate?
The canonical SMILES for 2-methylpropyl 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carboxylate is CC(C)COC(=O)c1cnc(Oc2ccc3c(c2)B(O)OC3)cn1.
What is the InChIKey of 2-methylpropyl 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carboxylate?
The InChIKey is OGIIEMDRGWOAOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17BN2O5/c1-10(2)8-22-16(20)14-6-19-15(7-18-14)24-12-4-3-11-9-23-17(21)13(11)5-12/h3-7,10,21H,8-9H2,1-2H3.
What are the key properties of 2-methylpropyl 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carboxylate?
2-methylpropyl 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carboxylate has a molecular weight of 328.13 g/mol, XLogP of 1.30, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazine-2-carboxylate is sourced from PubChem (CID 122178918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).