C36H54O5 — CID 122178952
(1R,6S,9R,10S,13S)-6-(2-hydroxypropan-2-yl)-9-methyl-10-(2-methylbutanoyl)-1,3,13-tris(3-methylbut-2-enyl)-5-oxatricyclo[7.2.2.04,10]tridec-3-ene-2,11-dione (PubChem CID 122178952) has the molecular formula C36H54O5 and a molecular weight of 566.82 g/mol. Its IUPAC name is (1R,6S,9R,10S,13S)-6-(2-hydroxypropan-2-yl)-9-methyl-10-(2-methylbutanoyl)-1,3,13-tris(3-methylbut-2-enyl)-5-oxatricyclo[7.2.2.04,10]tridec-3-ene-2,11-dione.
| Compound Name | (1R,6S,9R,10S,13S)-6-(2-hydroxypropan-2-yl)-9-methyl-10-(2-methylbutanoyl)-1,3,13-tris(3-methylbut-2-enyl)-5-oxatricyclo[7.2.2.04,10]tridec-3-ene-2,11-dione |
|---|---|
| PubChem CID | 122178952 |
| Molecular Formula | C36H54O5 |
| Molecular Weight | 566.82 g/mol |
| Exact Mass | 566.40 |
| IUPAC Name | (1R,6S,9R,10S,13S)-6-(2-hydroxypropan-2-yl)-9-methyl-10-(2-methylbutanoyl)-1,3,13-tris(3-methylbut-2-enyl)-5-oxatricyclo[7.2.2.04,10]tridec-3-ene-2,11-dione |
| SMILES | CCC(C)C(=O)[C@]12C(=O)[C@]3(CC=C(C)C)C[C@H](CC=C(C)C)[C@@]1(C)CC[C@@H](C(C)(C)O)OC2=C(CC=C(C)C)C3=O |
| InChI | InChI=1S/C36H54O5/c1-12-25(8)29(37)36-31-27(16-14-23(4)5)30(38)35(32(36)39,20-17-24(6)7)21-26(15-13-22(2)3)34(36,11)19-18-28(41-31)33(9,10)40/h13-14,17,25-26,28,40H,12,15-16,18-21H2,1-11H3/t25?,26-,28-,34+,35+,36-/m0/s1 |
| InChIKey | ZZLKTEYLJWEXBS-DPAIRFDSSA-N |
| XLogP | 8.03 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.82 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|