C38H48O4 — CID 122178964
(1R,3S,5R,7R,8S)-5-benzoyl-3-[(2E)-3,7-dimethylocta-2,6-dienyl]-6,6-dimethyl-1-(3-methylbut-2-enyl)-8-(2-methylprop-1-enyl)adamantane-2,4,9-trione (PubChem CID 122178964) has the molecular formula C38H48O4 and a molecular weight of 568.80 g/mol. Its IUPAC name is (1R,3S,5R,7R,8S)-5-benzoyl-3-[(2E)-3,7-dimethylocta-2,6-dienyl]-6,6-dimethyl-1-(3-methylbut-2-enyl)-8-(2-methylprop-1-enyl)adamantane-2,4,9-trione.
| Compound Name | (1R,3S,5R,7R,8S)-5-benzoyl-3-[(2E)-3,7-dimethylocta-2,6-dienyl]-6,6-dimethyl-1-(3-methylbut-2-enyl)-8-(2-methylprop-1-enyl)adamantane-2,4,9-trione |
|---|---|
| PubChem CID | 122178964 |
| Molecular Formula | C38H48O4 |
| Molecular Weight | 568.80 g/mol |
| Exact Mass | 568.36 |
| IUPAC Name | (1R,3S,5R,7R,8S)-5-benzoyl-3-[(2E)-3,7-dimethylocta-2,6-dienyl]-6,6-dimethyl-1-(3-methylbut-2-enyl)-8-(2-methylprop-1-enyl)adamantane-2,4,9-trione |
| SMILES | CC(C)=CCC/C(C)=C/C[C@]12C[C@@H]3[C@H](C=C(C)C)[C@](CC=C(C)C)(C1=O)C(=O)[C@](C(=O)c1ccccc1)(C2=O)C3(C)C |
| InChI | InChI=1S/C38H48O4/c1-24(2)14-13-15-27(7)19-20-36-23-30-29(22-26(5)6)37(32(36)40,21-18-25(3)4)34(42)38(33(36)41,35(30,8)9)31(39)28-16-11-10-12-17-28/h10-12,14,16-19,22,29-30H,13,15,20-21,23H2,1-9H3/b27-19+/t29-,30+,36-,37+,38-/m0/s1 |
| InChIKey | VMEJLYNTYLRLLY-MASYIOIESA-N |
| XLogP | 8.63 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.80 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|