C21H22O4 — CID 122179141
(4S,4aR,12bS)-4-(hydroxymethyl)-4,12b-dimethyl-2,3,4a,5-tetrahydro-1H-benzo[a]anthracene-6,8,11-trione (PubChem CID 122179141) has the molecular formula C21H22O4 and a molecular weight of 338.40 g/mol. Its IUPAC name is (4S,4aR,12bS)-4-(hydroxymethyl)-4,12b-dimethyl-2,3,4a,5-tetrahydro-1H-benzo[a]anthracene-6,8,11-trione.
| Compound Name | (4S,4aR,12bS)-4-(hydroxymethyl)-4,12b-dimethyl-2,3,4a,5-tetrahydro-1H-benzo[a]anthracene-6,8,11-trione |
|---|---|
| PubChem CID | 122179141 |
| Molecular Formula | C21H22O4 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (4S,4aR,12bS)-4-(hydroxymethyl)-4,12b-dimethyl-2,3,4a,5-tetrahydro-1H-benzo[a]anthracene-6,8,11-trione |
| SMILES | C[C@]1(CO)CCC[C@]2(C)c3cc4c(cc3C(=O)C[C@@H]12)C(=O)C=CC4=O |
| InChI | InChI=1S/C21H22O4/c1-20(11-22)6-3-7-21(2)15-9-13-12(16(23)4-5-17(13)24)8-14(15)18(25)10-19(20)21/h4-5,8-9,19,22H,3,6-7,10-11H2,1-2H3/t19-,20+,21+/m0/s1 |
| InChIKey | PCQUPBXXGWSGMS-PWRODBHTSA-N |
| XLogP | 3.26 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|