C19H14BrNO4 — CID 122179148
3-bromo-6-[(2S)-2,3-dihydroxypropyl]indeno[1,2-c]isoquinoline-5,11-dione (PubChem CID 122179148) has the molecular formula C19H14BrNO4 and a molecular weight of 400.23 g/mol. Its IUPAC name is 3-bromo-6-[(2S)-2,3-dihydroxypropyl]indeno[1,2-c]isoquinoline-5,11-dione.
| Compound Name | 3-bromo-6-[(2S)-2,3-dihydroxypropyl]indeno[1,2-c]isoquinoline-5,11-dione |
|---|---|
| PubChem CID | 122179148 |
| Molecular Formula | C19H14BrNO4 |
| Molecular Weight | 400.23 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | 3-bromo-6-[(2S)-2,3-dihydroxypropyl]indeno[1,2-c]isoquinoline-5,11-dione |
| SMILES | O=C1c2ccccc2-c2c1c1ccc(Br)cc1c(=O)n2C[C@H](O)CO |
| InChI | InChI=1S/C19H14BrNO4/c20-10-5-6-12-15(7-10)19(25)21(8-11(23)9-22)17-13-3-1-2-4-14(13)18(24)16(12)17/h1-7,11,22-23H,8-9H2/t11-/m0/s1 |
| InChIKey | NPYSFHYKUYONRX-NSHDSACASA-N |
| XLogP | 2.33 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.23 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|