C20H19N3O2 — CID 122179163
6-[3-(dimethylamino)propyl]indeno[1,2-c][2,7]naphthyridine-5,11-dione (PubChem CID 122179163) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is 6-[3-(dimethylamino)propyl]indeno[1,2-c][2,7]naphthyridine-5,11-dione.
| Compound Name | 6-[3-(dimethylamino)propyl]indeno[1,2-c][2,7]naphthyridine-5,11-dione |
|---|---|
| PubChem CID | 122179163 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 6-[3-(dimethylamino)propyl]indeno[1,2-c][2,7]naphthyridine-5,11-dione |
| SMILES | CN(C)CCCn1c2c(c3ccncc3c1=O)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C20H19N3O2/c1-22(2)10-5-11-23-18-14-6-3-4-7-15(14)19(24)17(18)13-8-9-21-12-16(13)20(23)25/h3-4,6-9,12H,5,10-11H2,1-2H3 |
| InChIKey | DUBDZPXTUCXYHD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|