C28H42O9 — CID 122179266
[(1R,2S,4R,5R,9S,10E,13S)-2,7-dihydroxy-1,5,9,12,12-pentamethyl-3,8-dioxo-16-oxabicyclo[11.2.1]hexadec-10-en-4-yl] (E,4R)-4-acetyloxy-3-methylpent-2-enoate (PubChem CID 122179266) has the molecular formula C28H42O9 and a molecular weight of 522.64 g/mol. Its IUPAC name is [(1R,2S,4R,5R,9S,10E,13S)-2,7-dihydroxy-1,5,9,12,12-pentamethyl-3,8-dioxo-16-oxabicyclo[11.2.1]hexadec-10-en-4-yl] (E,4R)-4-acetyloxy-3-methylpent-2-enoate.
| Compound Name | [(1R,2S,4R,5R,9S,10E,13S)-2,7-dihydroxy-1,5,9,12,12-pentamethyl-3,8-dioxo-16-oxabicyclo[11.2.1]hexadec-10-en-4-yl] (E,4R)-4-acetyloxy-3-methylpent-2-enoate |
|---|---|
| PubChem CID | 122179266 |
| Molecular Formula | C28H42O9 |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | [(1R,2S,4R,5R,9S,10E,13S)-2,7-dihydroxy-1,5,9,12,12-pentamethyl-3,8-dioxo-16-oxabicyclo[11.2.1]hexadec-10-en-4-yl] (E,4R)-4-acetyloxy-3-methylpent-2-enoate |
| SMILES | CC(=O)O[C@H](C)/C(C)=C/C(=O)O[C@H]1C(=O)[C@@H](O)[C@@]2(C)CC[C@H](O2)C(C)(C)/C=C/[C@H](C)C(=O)C(O)C[C@H]1C |
| InChI | InChI=1S/C28H42O9/c1-15-9-11-27(6,7)21-10-12-28(8,37-21)26(34)24(33)25(17(3)13-20(30)23(15)32)36-22(31)14-16(2)18(4)35-19(5)29/h9,11,14-15,17-18,20-21,25-26,30,34H,10,12-13H2,1-8H3/b11-9+,16-14+/t15-,17+,18+,20?,21-,25+,26+,28+/m0/s1 |
| InChIKey | LVUYCISLNYNHLM-UQQPGFJUSA-N |
| XLogP | 2.85 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|