C26H40O9 — CID 122179268
(E)-5-[(2S,5R)-5-[(1S)-5-carboxy-1-hydroxy-4-methyl-3-[(E)-3-methylpent-2-enoyl]oxy-2-oxopentyl]-5-methyloxolan-2-yl]-2,5-dimethylhex-3-enoic acid (PubChem CID 122179268) has the molecular formula C26H40O9 and a molecular weight of 496.60 g/mol. Its IUPAC name is (E)-5-[(2S,5R)-5-[(1S)-5-carboxy-1-hydroxy-4-methyl-3-[(E)-3-methylpent-2-enoyl]oxy-2-oxopentyl]-5-methyloxolan-2-yl]-2,5-dimethylhex-3-enoic acid.
| Compound Name | (E)-5-[(2S,5R)-5-[(1S)-5-carboxy-1-hydroxy-4-methyl-3-[(E)-3-methylpent-2-enoyl]oxy-2-oxopentyl]-5-methyloxolan-2-yl]-2,5-dimethylhex-3-enoic acid |
|---|---|
| PubChem CID | 122179268 |
| Molecular Formula | C26H40O9 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | (E)-5-[(2S,5R)-5-[(1S)-5-carboxy-1-hydroxy-4-methyl-3-[(E)-3-methylpent-2-enoyl]oxy-2-oxopentyl]-5-methyloxolan-2-yl]-2,5-dimethylhex-3-enoic acid |
| SMILES | CC/C(C)=C/C(=O)OC(C(=O)[C@@H](O)[C@@]1(C)CC[C@@H](C(C)(C)/C=C/C(C)C(=O)O)O1)C(C)CC(=O)O |
| InChI | InChI=1S/C26H40O9/c1-8-15(2)13-20(29)34-22(17(4)14-19(27)28)21(30)23(31)26(7)12-10-18(35-26)25(5,6)11-9-16(3)24(32)33/h9,11,13,16-18,22-23,31H,8,10,12,14H2,1-7H3,(H,27,28)(H,32,33)/b11-9+,15-13+/t16?,17?,18-,22?,23+,26+/m0/s1 |
| InChIKey | OGFVGXHKWVSOCS-GTOCYKSNSA-N |
| XLogP | 3.54 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|