C15H8N4O — CID 122179405
12-(furan-3-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile (PubChem CID 122179405) has the molecular formula C15H8N4O and a molecular weight of 260.26 g/mol. Its IUPAC name is 12-(furan-3-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile.
| Compound Name | 12-(furan-3-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 122179405 |
| Molecular Formula | C15H8N4O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 12-(furan-3-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
| SMILES | N#Cc1cc2c(cn1)[nH]c1ncc(-c3ccoc3)cc12 |
| InChI | InChI=1S/C15H8N4O/c16-5-11-4-12-13-3-10(9-1-2-20-8-9)6-18-15(13)19-14(12)7-17-11/h1-4,6-8H,(H,18,19) |
| InChIKey | KZSZKBQXNVVBFG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 78.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |