C37H52N2O3 — CID 122179418
(4aS,6aR,6bS,8aR,12aS,14aR,14bS)-11-cyano-N-cyclohexyl-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carboxamide (PubChem CID 122179418) has the molecular formula C37H52N2O3 and a molecular weight of 572.83 g/mol. Its IUPAC name is (4aS,6aR,6bS,8aR,12aS,14aR,14bS)-11-cyano-N-cyclohexyl-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carboxamide.
| Compound Name | (4aS,6aR,6bS,8aR,12aS,14aR,14bS)-11-cyano-N-cyclohexyl-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carboxamide |
|---|---|
| PubChem CID | 122179418 |
| Molecular Formula | C37H52N2O3 |
| Molecular Weight | 572.83 g/mol |
| Exact Mass | 572.40 |
| IUPAC Name | (4aS,6aR,6bS,8aR,12aS,14aR,14bS)-11-cyano-N-cyclohexyl-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carboxamide |
| SMILES | CC1(C)CC[C@]2(C(=O)NC3CCCCC3)CC[C@]3(C)[C@H](C(=O)C=C4[C@@]5(C)C=C(C#N)C(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C37H52N2O3/c1-32(2)15-17-37(31(42)39-24-11-9-8-10-12-24)18-16-36(7)29(25(37)21-32)26(40)19-28-34(5)20-23(22-38)30(41)33(3,4)27(34)13-14-35(28,36)6/h19-20,24-25,27,29H,8-18,21H2,1-7H3,(H,39,42)/t25-,27-,29-,34-,35+,36+,37-/m0/s1 |
| InChIKey | INAGXBXHTYAGHE-INFDGNIISA-N |
| XLogP | 7.65 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.83 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |