C21H15F2N5O3S — CID 122179527
N-[3-[2-(3-ethoxy-1H-pyrazolo[5,4-b]pyridin-5-yl)ethynyl]-2,4-difluorophenyl]pyridine-3-sulfonamide (PubChem CID 122179527) has the molecular formula C21H15F2N5O3S and a molecular weight of 455.45 g/mol. Its IUPAC name is N-[3-[2-(3-ethoxy-1H-pyrazolo[5,4-b]pyridin-5-yl)ethynyl]-2,4-difluorophenyl]pyridine-3-sulfonamide.
| Compound Name | N-[3-[2-(3-ethoxy-1H-pyrazolo[5,4-b]pyridin-5-yl)ethynyl]-2,4-difluorophenyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 122179527 |
| Molecular Formula | C21H15F2N5O3S |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | N-[3-[2-(3-ethoxy-1H-pyrazolo[5,4-b]pyridin-5-yl)ethynyl]-2,4-difluorophenyl]pyridine-3-sulfonamide |
| SMILES | CCOc1n[nH]c2ncc(C#Cc3c(F)ccc(NS(=O)(=O)c4cccnc4)c3F)cc12 |
| InChI | InChI=1S/C21H15F2N5O3S/c1-2-31-21-16-10-13(11-25-20(16)26-27-21)5-6-15-17(22)7-8-18(19(15)23)28-32(29,30)14-4-3-9-24-12-14/h3-4,7-12,28H,2H2,1H3,(H,25,26,27) |
| InChIKey | PNHLZOKSEBWVOX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|