C47H42Cl2N4O4 — CID 122179602
9-[9-[(3-chlorophenyl)methyl]pyrido[3,4-b]indole-3-carbonyl]oxynonyl 9-[(3-chlorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate (PubChem CID 122179602) has the molecular formula C47H42Cl2N4O4 and a molecular weight of 797.78 g/mol. Its IUPAC name is 9-[9-[(3-chlorophenyl)methyl]pyrido[3,4-b]indole-3-carbonyl]oxynonyl 9-[(3-chlorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | 9-[9-[(3-chlorophenyl)methyl]pyrido[3,4-b]indole-3-carbonyl]oxynonyl 9-[(3-chlorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 122179602 |
| Molecular Formula | C47H42Cl2N4O4 |
| Molecular Weight | 797.78 g/mol |
| Exact Mass | 796.26 |
| IUPAC Name | 9-[9-[(3-chlorophenyl)methyl]pyrido[3,4-b]indole-3-carbonyl]oxynonyl 9-[(3-chlorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate |
| SMILES | O=C(OCCCCCCCCCOC(=O)c1cc2c3ccccc3n(Cc3cccc(Cl)c3)c2cn1)c1cc2c3ccccc3n(Cc3cccc(Cl)c3)c2cn1 |
| InChI | InChI=1S/C47H42Cl2N4O4/c48-34-16-12-14-32(24-34)30-52-42-20-8-6-18-36(42)38-26-40(50-28-44(38)52)46(54)56-22-10-4-2-1-3-5-11-23-57-47(55)41-27-39-37-19-7-9-21-43(37)53(45(39)29-51-41)31-33-15-13-17-35(49)25-33/h6-9,12-21,24-29H,1-5,10-11,22-23,30-31H2 |
| InChIKey | FFALWYZXKIXNSO-UHFFFAOYSA-N |
| XLogP | 11.84 |
| TPSA | 88.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.78 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|