About 5-(5-amino-3-pyridinyl)-3-methyl-8-(piperidin-4-ylamino)-1H-1,7-naphthyridin-2-one
5-(5-amino-3-pyridinyl)-3-methyl-8-(piperidin-4-ylamino)-1H-1,7-naphthyridin-2-one (PubChem CID 122179615) has the molecular formula C19H22N6O
and a molecular weight of 350.43 g/mol. Its IUPAC name is 5-(5-amino-3-pyridinyl)-3-methyl-8-(piperidin-4-ylamino)-1H-1,7-naphthyridin-2-one.
Molecular Properties
| Compound Name | 5-(5-amino-3-pyridinyl)-3-methyl-8-(piperidin-4-ylamino)-1H-1,7-naphthyridin-2-one |
| PubChem CID | 122179615 |
| Molecular Formula | C19H22N6O |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 5-(5-amino-3-pyridinyl)-3-methyl-8-(piperidin-4-ylamino)-1H-1,7-naphthyridin-2-one |
| SMILES | Cc1cc2c(-c3cncc(N)c3)cnc(NC3CCNCC3)c2[nH]c1=O |
| InChI | InChI=1S/C19H22N6O/c1-11-6-15-16(12-7-13(20)9-22-8-12)10-23-18(17(15)25-19(11)26)24-14-2-4-21-5-3-14/h6-10,14,21H,2-5,20H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | YYIZMKLHVKMWIJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(5-amino-3-pyridinyl)-3-methyl-8-(piperidin-4-ylamino)-1H-1,7-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-amino-3-pyridinyl)-3-methyl-8-(piperidin-4-ylamino)-1H-1,7-naphthyridin-2-one?
The IUPAC name of 5-(5-amino-3-pyridinyl)-3-methyl-8-(piperidin-4-ylamino)-1H-1,7-naphthyridin-2-one (CID 122179615) is 5-(5-amino-3-pyridinyl)-3-methyl-8-(piperidin-4-ylamino)-1H-1,7-naphthyridin-2-one.
What is the SMILES notation for 5-(5-amino-3-pyridinyl)-3-methyl-8-(piperidin-4-ylamino)-1H-1,7-naphthyridin-2-one?
The canonical SMILES for 5-(5-amino-3-pyridinyl)-3-methyl-8-(piperidin-4-ylamino)-1H-1,7-naphthyridin-2-one is Cc1cc2c(-c3cncc(N)c3)cnc(NC3CCNCC3)c2[nH]c1=O.
What is the InChIKey of 5-(5-amino-3-pyridinyl)-3-methyl-8-(piperidin-4-ylamino)-1H-1,7-naphthyridin-2-one?
The InChIKey is YYIZMKLHVKMWIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N6O/c1-11-6-15-16(12-7-13(20)9-22-8-12)10-23-18(17(15)25-19(11)26)24-14-2-4-21-5-3-14/h6-10,14,21H,2-5,20H2,1H3,(H,23,24)(H,25,26).
What are the key properties of 5-(5-amino-3-pyridinyl)-3-methyl-8-(piperidin-4-ylamino)-1H-1,7-naphthyridin-2-one?
5-(5-amino-3-pyridinyl)-3-methyl-8-(piperidin-4-ylamino)-1H-1,7-naphthyridin-2-one has a molecular weight of 350.43 g/mol, XLogP of 2.04, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-amino-3-pyridinyl)-3-methyl-8-(piperidin-4-ylamino)-1H-1,7-naphthyridin-2-one is sourced from PubChem (CID 122179615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).