C26H38O3 — CID 122179731
cyclohexyl 3-[(1R,4R,5R,6S,9S)-5-methyl-10-methylidene-11-oxo-4-prop-1-en-2-yl-5-tricyclo[7.2.1.01,6]dodecanyl]propanoate (PubChem CID 122179731) has the molecular formula C26H38O3 and a molecular weight of 398.59 g/mol. Its IUPAC name is cyclohexyl 3-[(1R,4R,5R,6S,9S)-5-methyl-10-methylidene-11-oxo-4-prop-1-en-2-yl-5-tricyclo[7.2.1.01,6]dodecanyl]propanoate.
| Compound Name | cyclohexyl 3-[(1R,4R,5R,6S,9S)-5-methyl-10-methylidene-11-oxo-4-prop-1-en-2-yl-5-tricyclo[7.2.1.01,6]dodecanyl]propanoate |
|---|---|
| PubChem CID | 122179731 |
| Molecular Formula | C26H38O3 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | cyclohexyl 3-[(1R,4R,5R,6S,9S)-5-methyl-10-methylidene-11-oxo-4-prop-1-en-2-yl-5-tricyclo[7.2.1.01,6]dodecanyl]propanoate |
| SMILES | C=C1C(=O)[C@@]23CC[C@H](C(=C)C)[C@@](C)(CCC(=O)OC4CCCCC4)[C@@H]2CC[C@H]1C3 |
| InChI | InChI=1S/C26H38O3/c1-17(2)21-12-15-26-16-19(18(3)24(26)28)10-11-22(26)25(21,4)14-13-23(27)29-20-8-6-5-7-9-20/h19-22H,1,3,5-16H2,2,4H3/t19-,21+,22-,25+,26+/m0/s1 |
| InChIKey | NLPSCJTVXQJMIE-JDTMTQPXSA-N |
| XLogP | 6.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|