C27H34O3 — CID 122179732
benzyl 3-[(1R,4R,5R,6S,9S)-5-methyl-10-methylidene-11-oxo-4-prop-1-en-2-yl-5-tricyclo[7.2.1.01,6]dodecanyl]propanoate (PubChem CID 122179732) has the molecular formula C27H34O3 and a molecular weight of 406.57 g/mol. Its IUPAC name is benzyl 3-[(1R,4R,5R,6S,9S)-5-methyl-10-methylidene-11-oxo-4-prop-1-en-2-yl-5-tricyclo[7.2.1.01,6]dodecanyl]propanoate.
| Compound Name | benzyl 3-[(1R,4R,5R,6S,9S)-5-methyl-10-methylidene-11-oxo-4-prop-1-en-2-yl-5-tricyclo[7.2.1.01,6]dodecanyl]propanoate |
|---|---|
| PubChem CID | 122179732 |
| Molecular Formula | C27H34O3 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | benzyl 3-[(1R,4R,5R,6S,9S)-5-methyl-10-methylidene-11-oxo-4-prop-1-en-2-yl-5-tricyclo[7.2.1.01,6]dodecanyl]propanoate |
| SMILES | C=C1C(=O)[C@@]23CC[C@H](C(=C)C)[C@@](C)(CCC(=O)OCc4ccccc4)[C@@H]2CC[C@H]1C3 |
| InChI | InChI=1S/C27H34O3/c1-18(2)22-12-15-27-16-21(19(3)25(27)29)10-11-23(27)26(22,4)14-13-24(28)30-17-20-8-6-5-7-9-20/h5-9,21-23H,1,3,10-17H2,2,4H3/t21-,22+,23-,26+,27+/m0/s1 |
| InChIKey | OZTQFTVGZCIRCV-XHMYXGOJSA-N |
| XLogP | 6.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|