C22H34O4 — CID 122179738
3-[(1R,4R,5R,6S,9S)-10-(ethoxymethyl)-5-methyl-11-oxo-4-prop-1-en-2-yl-5-tricyclo[7.2.1.01,6]dodecanyl]propanoic acid (PubChem CID 122179738) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is 3-[(1R,4R,5R,6S,9S)-10-(ethoxymethyl)-5-methyl-11-oxo-4-prop-1-en-2-yl-5-tricyclo[7.2.1.01,6]dodecanyl]propanoic acid.
| Compound Name | 3-[(1R,4R,5R,6S,9S)-10-(ethoxymethyl)-5-methyl-11-oxo-4-prop-1-en-2-yl-5-tricyclo[7.2.1.01,6]dodecanyl]propanoic acid |
|---|---|
| PubChem CID | 122179738 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 3-[(1R,4R,5R,6S,9S)-10-(ethoxymethyl)-5-methyl-11-oxo-4-prop-1-en-2-yl-5-tricyclo[7.2.1.01,6]dodecanyl]propanoic acid |
| SMILES | C=C(C)[C@H]1CC[C@@]23C[C@H](CC[C@H]2[C@]1(C)CCC(=O)O)C(COCC)C3=O |
| InChI | InChI=1S/C22H34O4/c1-5-26-13-16-15-6-7-18-21(4,10-9-19(23)24)17(14(2)3)8-11-22(18,12-15)20(16)25/h15-18H,2,5-13H2,1,3-4H3,(H,23,24)/t15-,16?,17+,18-,21+,22+/m0/s1 |
| InChIKey | GGLKAAQUOZUMSR-WHRWCXQTSA-N |
| XLogP | 4.48 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|