C27H42NO6P — CID 122179743
methyl 3-[(1R,4R,5R,6S,9S)-10-(2-cyano-2-diethoxyphosphorylethyl)-5-methyl-11-oxo-4-prop-1-en-2-yl-5-tricyclo[7.2.1.01,6]dodecanyl]propanoate (PubChem CID 122179743) has the molecular formula C27H42NO6P and a molecular weight of 507.61 g/mol. Its IUPAC name is methyl 3-[(1R,4R,5R,6S,9S)-10-(2-cyano-2-diethoxyphosphorylethyl)-5-methyl-11-oxo-4-prop-1-en-2-yl-5-tricyclo[7.2.1.01,6]dodecanyl]propanoate.
| Compound Name | methyl 3-[(1R,4R,5R,6S,9S)-10-(2-cyano-2-diethoxyphosphorylethyl)-5-methyl-11-oxo-4-prop-1-en-2-yl-5-tricyclo[7.2.1.01,6]dodecanyl]propanoate |
|---|---|
| PubChem CID | 122179743 |
| Molecular Formula | C27H42NO6P |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | methyl 3-[(1R,4R,5R,6S,9S)-10-(2-cyano-2-diethoxyphosphorylethyl)-5-methyl-11-oxo-4-prop-1-en-2-yl-5-tricyclo[7.2.1.01,6]dodecanyl]propanoate |
| SMILES | C=C(C)[C@H]1CC[C@@]23C[C@H](CC[C@H]2[C@]1(C)CCC(=O)OC)C(CC(C#N)P(=O)(OCC)OCC)C3=O |
| InChI | InChI=1S/C27H42NO6P/c1-7-33-35(31,34-8-2)20(17-28)15-21-19-9-10-23-26(5,13-12-24(29)32-6)22(18(3)4)11-14-27(23,16-19)25(21)30/h19-23H,3,7-16H2,1-2,4-6H3/t19-,20?,21?,22+,23-,26+,27+/m0/s1 |
| InChIKey | QFGCOPGINMHKPR-YMZCGYILSA-N |
| XLogP | 6.08 |
| TPSA | 102.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|