C17H18FN3 — CID 122179744
2,5,6,7-tetradeuterio-N-(3-fluoro-4-pyridinyl)-N-(1,1,2,2,3,3,3-heptadeuteriopropyl)-3-(trideuteriomethyl)indol-1-amine (PubChem CID 122179744) has the molecular formula C17H18FN3 and a molecular weight of 297.44 g/mol. Its IUPAC name is 2,5,6,7-tetradeuterio-N-(3-fluoro-4-pyridinyl)-N-(1,1,2,2,3,3,3-heptadeuteriopropyl)-3-(trideuteriomethyl)indol-1-amine.
| Compound Name | 2,5,6,7-tetradeuterio-N-(3-fluoro-4-pyridinyl)-N-(1,1,2,2,3,3,3-heptadeuteriopropyl)-3-(trideuteriomethyl)indol-1-amine |
|---|---|
| PubChem CID | 122179744 |
| Molecular Formula | C17H18FN3 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.24 |
| IUPAC Name | 2,5,6,7-tetradeuterio-N-(3-fluoro-4-pyridinyl)-N-(1,1,2,2,3,3,3-heptadeuteriopropyl)-3-(trideuteriomethyl)indol-1-amine |
| SMILES | [2H]c1cc2c(C([2H])([2H])[2H])c([2H])n(N(c3ccncc3F)C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H])c2c([2H])c1[2H] |
| InChI | InChI=1S/C17H18FN3/c1-3-10-20(17-8-9-19-11-15(17)18)21-12-13(2)14-6-4-5-7-16(14)21/h4-9,11-12H,3,10H2,1-2H3/i1D3,2D3,3D2,4D,5D,7D,10D2,12D |
| InChIKey | BTDHTARYCBHHPJ-VSNDFMTHSA-N |
| XLogP | 4.16 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |