About 5-[4-[(3,4-difluorophenyl)carbamoylamino]phenyl]-N-methylpyridine-2-carboxamide
5-[4-[(3,4-difluorophenyl)carbamoylamino]phenyl]-N-methylpyridine-2-carboxamide (PubChem CID 122180067) has the molecular formula C20H16F2N4O2
and a molecular weight of 382.37 g/mol. Its IUPAC name is 5-[4-[(3,4-difluorophenyl)carbamoylamino]phenyl]-N-methylpyridine-2-carboxamide.
Molecular Properties
| Compound Name | 5-[4-[(3,4-difluorophenyl)carbamoylamino]phenyl]-N-methylpyridine-2-carboxamide |
| PubChem CID | 122180067 |
| Molecular Formula | C20H16F2N4O2 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 5-[4-[(3,4-difluorophenyl)carbamoylamino]phenyl]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1ccc(-c2ccc(NC(=O)Nc3ccc(F)c(F)c3)cc2)cn1 |
| InChI | InChI=1S/C20H16F2N4O2/c1-23-19(27)18-9-4-13(11-24-18)12-2-5-14(6-3-12)25-20(28)26-15-7-8-16(21)17(22)10-15/h2-11H,1H3,(H,23,27)(H2,25,26,28) |
| InChIKey | BOVUIWPJPWHRHQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[4-[(3,4-difluorophenyl)carbamoylamino]phenyl]-N-methylpyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-[(3,4-difluorophenyl)carbamoylamino]phenyl]-N-methylpyridine-2-carboxamide?
The IUPAC name of 5-[4-[(3,4-difluorophenyl)carbamoylamino]phenyl]-N-methylpyridine-2-carboxamide (CID 122180067) is 5-[4-[(3,4-difluorophenyl)carbamoylamino]phenyl]-N-methylpyridine-2-carboxamide.
What is the SMILES notation for 5-[4-[(3,4-difluorophenyl)carbamoylamino]phenyl]-N-methylpyridine-2-carboxamide?
The canonical SMILES for 5-[4-[(3,4-difluorophenyl)carbamoylamino]phenyl]-N-methylpyridine-2-carboxamide is CNC(=O)c1ccc(-c2ccc(NC(=O)Nc3ccc(F)c(F)c3)cc2)cn1.
What is the InChIKey of 5-[4-[(3,4-difluorophenyl)carbamoylamino]phenyl]-N-methylpyridine-2-carboxamide?
The InChIKey is BOVUIWPJPWHRHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16F2N4O2/c1-23-19(27)18-9-4-13(11-24-18)12-2-5-14(6-3-12)25-20(28)26-15-7-8-16(21)17(22)10-15/h2-11H,1H3,(H,23,27)(H2,25,26,28).
What are the key properties of 5-[4-[(3,4-difluorophenyl)carbamoylamino]phenyl]-N-methylpyridine-2-carboxamide?
5-[4-[(3,4-difluorophenyl)carbamoylamino]phenyl]-N-methylpyridine-2-carboxamide has a molecular weight of 382.37 g/mol, XLogP of 4.03, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-[(3,4-difluorophenyl)carbamoylamino]phenyl]-N-methylpyridine-2-carboxamide is sourced from PubChem (CID 122180067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).