C34H45N5O6 — CID 122180122
N-[3-[4-(dibenzylamino)butylamino]propyl]-N'-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]butanediamide (PubChem CID 122180122) has the molecular formula C34H45N5O6 and a molecular weight of 619.76 g/mol. Its IUPAC name is N-[3-[4-(dibenzylamino)butylamino]propyl]-N'-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]butanediamide.
| Compound Name | N-[3-[4-(dibenzylamino)butylamino]propyl]-N'-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]butanediamide |
|---|---|
| PubChem CID | 122180122 |
| Molecular Formula | C34H45N5O6 |
| Molecular Weight | 619.76 g/mol |
| Exact Mass | 619.34 |
| IUPAC Name | N-[3-[4-(dibenzylamino)butylamino]propyl]-N'-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]butanediamide |
| SMILES | O=C(CCC(=O)N[C@H](CO)[C@H](O)c1ccc([N+](=O)[O-])cc1)NCCCNCCCCN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C34H45N5O6/c40-26-31(34(43)29-14-16-30(17-15-29)39(44)45)37-33(42)19-18-32(41)36-22-9-21-35-20-7-8-23-38(24-27-10-3-1-4-11-27)25-28-12-5-2-6-13-28/h1-6,10-17,31,34-35,40,43H,7-9,18-26H2,(H,36,41)(H,37,42)/t31-,34-/m1/s1 |
| InChIKey | NSRMBSSIRRRDFQ-QIKUIUABSA-N |
| XLogP | 3.46 |
| TPSA | 157.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.76 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|