C24H24N4O — CID 122180327
[(3aS,6aR)-2-(4-methylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-phenylphenyl)methanone (PubChem CID 122180327) has the molecular formula C24H24N4O and a molecular weight of 384.48 g/mol. Its IUPAC name is [(3aS,6aR)-2-(4-methylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-phenylphenyl)methanone.
| Compound Name | [(3aS,6aR)-2-(4-methylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-phenylphenyl)methanone |
|---|---|
| PubChem CID | 122180327 |
| Molecular Formula | C24H24N4O |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | [(3aS,6aR)-2-(4-methylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-phenylphenyl)methanone |
| SMILES | Cc1ccnc(N2C[C@H]3CN(C(=O)c4ccccc4-c4ccccc4)C[C@H]3C2)n1 |
| InChI | InChI=1S/C24H24N4O/c1-17-11-12-25-24(26-17)28-15-19-13-27(14-20(19)16-28)23(29)22-10-6-5-9-21(22)18-7-3-2-4-8-18/h2-12,19-20H,13-16H2,1H3/t19-,20+ |
| InChIKey | FWWNHEYEKVWHKE-BGYRXZFFSA-N |
| XLogP | 3.66 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |