C24H22N6O — CID 122180328
[(3aR,6aS)-2-quinoxalin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-pyrazol-1-ylphenyl)methanone (PubChem CID 122180328) has the molecular formula C24H22N6O and a molecular weight of 410.48 g/mol. Its IUPAC name is [(3aR,6aS)-2-quinoxalin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-pyrazol-1-ylphenyl)methanone.
| Compound Name | [(3aR,6aS)-2-quinoxalin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-pyrazol-1-ylphenyl)methanone |
|---|---|
| PubChem CID | 122180328 |
| Molecular Formula | C24H22N6O |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | [(3aR,6aS)-2-quinoxalin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-pyrazol-1-ylphenyl)methanone |
| SMILES | O=C(c1ccccc1-n1cccn1)N1C[C@@H]2CN(c3cnc4ccccc4n3)C[C@@H]2C1 |
| InChI | InChI=1S/C24H22N6O/c31-24(19-6-1-4-9-22(19)30-11-5-10-26-30)29-15-17-13-28(14-18(17)16-29)23-12-25-20-7-2-3-8-21(20)27-23/h1-12,17-18H,13-16H2/t17-,18+ |
| InChIKey | YRKJMIKRCCBMEB-HDICACEKSA-N |
| XLogP | 3.02 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |