About 2-[[[(3S)-3,5-diaminopentanoyl]amino]-methylamino]-N-ethylacetamide
2-[[[(3S)-3,5-diaminopentanoyl]amino]-methylamino]-N-ethylacetamide (PubChem CID 122180376) has the molecular formula C10H23N5O2
and a molecular weight of 245.33 g/mol. Its IUPAC name is 2-[[[(3S)-3,5-diaminopentanoyl]amino]-methylamino]-N-ethylacetamide.
Molecular Properties
| Compound Name | 2-[[[(3S)-3,5-diaminopentanoyl]amino]-methylamino]-N-ethylacetamide |
| PubChem CID | 122180376 |
| Molecular Formula | C10H23N5O2 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 2-[[[(3S)-3,5-diaminopentanoyl]amino]-methylamino]-N-ethylacetamide |
| SMILES | CCNC(=O)CN(C)NC(=O)C[C@@H](N)CCN |
| InChI | InChI=1S/C10H23N5O2/c1-3-13-10(17)7-15(2)14-9(16)6-8(12)4-5-11/h8H,3-7,11-12H2,1-2H3,(H,13,17)(H,14,16)/t8-/m0/s1 |
| InChIKey | CPVKQCHKSMPUDU-QMMMGPOBSA-N |
| XLogP | -1.85 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[[[(3S)-3,5-diaminopentanoyl]amino]-methylamino]-N-ethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[[(3S)-3,5-diaminopentanoyl]amino]-methylamino]-N-ethylacetamide?
The IUPAC name of 2-[[[(3S)-3,5-diaminopentanoyl]amino]-methylamino]-N-ethylacetamide (CID 122180376) is 2-[[[(3S)-3,5-diaminopentanoyl]amino]-methylamino]-N-ethylacetamide.
What is the SMILES notation for 2-[[[(3S)-3,5-diaminopentanoyl]amino]-methylamino]-N-ethylacetamide?
The canonical SMILES for 2-[[[(3S)-3,5-diaminopentanoyl]amino]-methylamino]-N-ethylacetamide is CCNC(=O)CN(C)NC(=O)C[C@@H](N)CCN.
What is the InChIKey of 2-[[[(3S)-3,5-diaminopentanoyl]amino]-methylamino]-N-ethylacetamide?
The InChIKey is CPVKQCHKSMPUDU-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H23N5O2/c1-3-13-10(17)7-15(2)14-9(16)6-8(12)4-5-11/h8H,3-7,11-12H2,1-2H3,(H,13,17)(H,14,16)/t8-/m0/s1.
What are the key properties of 2-[[[(3S)-3,5-diaminopentanoyl]amino]-methylamino]-N-ethylacetamide?
2-[[[(3S)-3,5-diaminopentanoyl]amino]-methylamino]-N-ethylacetamide has a molecular weight of 245.33 g/mol, XLogP of -1.85, 8 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[[(3S)-3,5-diaminopentanoyl]amino]-methylamino]-N-ethylacetamide is sourced from PubChem (CID 122180376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).