About 5-[4-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]triazol-1-yl]-1H-indole
5-[4-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]triazol-1-yl]-1H-indole (PubChem CID 122180574) has the molecular formula C24H26Cl2N6
and a molecular weight of 469.42 g/mol. Its IUPAC name is 5-[4-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]triazol-1-yl]-1H-indole.
Molecular Properties
| Compound Name | 5-[4-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]triazol-1-yl]-1H-indole |
| PubChem CID | 122180574 |
| Molecular Formula | C24H26Cl2N6 |
| Molecular Weight | 469.42 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 5-[4-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]triazol-1-yl]-1H-indole |
| SMILES | Clc1cccc(N2CCN(CCCCc3cn(-c4ccc5[nH]ccc5c4)nn3)CC2)c1Cl |
| InChI | InChI=1S/C24H26Cl2N6/c25-21-5-3-6-23(24(21)26)31-14-12-30(13-15-31)11-2-1-4-19-17-32(29-28-19)20-7-8-22-18(16-20)9-10-27-22/h3,5-10,16-17,27H,1-2,4,11-15H2 |
| InChIKey | MMWBGBOMWXSDFR-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 52.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.42 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]triazol-1-yl]-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]triazol-1-yl]-1H-indole?
The IUPAC name of 5-[4-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]triazol-1-yl]-1H-indole (CID 122180574) is 5-[4-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]triazol-1-yl]-1H-indole.
What is the SMILES notation for 5-[4-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]triazol-1-yl]-1H-indole?
The canonical SMILES for 5-[4-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]triazol-1-yl]-1H-indole is Clc1cccc(N2CCN(CCCCc3cn(-c4ccc5[nH]ccc5c4)nn3)CC2)c1Cl.
What is the InChIKey of 5-[4-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]triazol-1-yl]-1H-indole?
The InChIKey is MMWBGBOMWXSDFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26Cl2N6/c25-21-5-3-6-23(24(21)26)31-14-12-30(13-15-31)11-2-1-4-19-17-32(29-28-19)20-7-8-22-18(16-20)9-10-27-22/h3,5-10,16-17,27H,1-2,4,11-15H2.
What are the key properties of 5-[4-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]triazol-1-yl]-1H-indole?
5-[4-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]triazol-1-yl]-1H-indole has a molecular weight of 469.42 g/mol, XLogP of 5.20, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]triazol-1-yl]-1H-indole is sourced from PubChem (CID 122180574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).