C22H27N5O2S — CID 122180794
8-ethyl-11-(4-methoxyphenyl)-13-morpholin-4-yl-6,8,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene-7-thione (PubChem CID 122180794) has the molecular formula C22H27N5O2S and a molecular weight of 425.56 g/mol. Its IUPAC name is 8-ethyl-11-(4-methoxyphenyl)-13-morpholin-4-yl-6,8,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene-7-thione.
| Compound Name | 8-ethyl-11-(4-methoxyphenyl)-13-morpholin-4-yl-6,8,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene-7-thione |
|---|---|
| PubChem CID | 122180794 |
| Molecular Formula | C22H27N5O2S |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 8-ethyl-11-(4-methoxyphenyl)-13-morpholin-4-yl-6,8,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene-7-thione |
| SMILES | CCN1C(=S)N2CCCC2c2c(N3CCOCC3)nc(-c3ccc(OC)cc3)nc21 |
| InChI | InChI=1S/C22H27N5O2S/c1-3-26-21-18(17-5-4-10-27(17)22(26)30)20(25-11-13-29-14-12-25)23-19(24-21)15-6-8-16(28-2)9-7-15/h6-9,17H,3-5,10-14H2,1-2H3 |
| InChIKey | MLUMXMVEGLESPK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 53.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|