C35H60O13 — CID 122180953
[(2S,3S,4S,5R,6R)-4-[(2S,3R,4R,5S,6S)-3,5-diacetyloxy-6-methyl-4-(3-methylbutanoyloxy)oxan-2-yl]oxy-5-hydroxy-2-methyl-6-octoxyoxan-3-yl] hexanoate (PubChem CID 122180953) has the molecular formula C35H60O13 and a molecular weight of 688.85 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6R)-4-[(2S,3R,4R,5S,6S)-3,5-diacetyloxy-6-methyl-4-(3-methylbutanoyloxy)oxan-2-yl]oxy-5-hydroxy-2-methyl-6-octoxyoxan-3-yl] hexanoate.
| Compound Name | [(2S,3S,4S,5R,6R)-4-[(2S,3R,4R,5S,6S)-3,5-diacetyloxy-6-methyl-4-(3-methylbutanoyloxy)oxan-2-yl]oxy-5-hydroxy-2-methyl-6-octoxyoxan-3-yl] hexanoate |
|---|---|
| PubChem CID | 122180953 |
| Molecular Formula | C35H60O13 |
| Molecular Weight | 688.85 g/mol |
| Exact Mass | 688.40 |
| IUPAC Name | [(2S,3S,4S,5R,6R)-4-[(2S,3R,4R,5S,6S)-3,5-diacetyloxy-6-methyl-4-(3-methylbutanoyloxy)oxan-2-yl]oxy-5-hydroxy-2-methyl-6-octoxyoxan-3-yl] hexanoate |
| SMILES | CCCCCCCCO[C@@H]1O[C@@H](C)[C@H](OC(=O)CCCCC)[C@@H](O[C@@H]2O[C@@H](C)[C@H](OC(C)=O)[C@@H](OC(=O)CC(C)C)[C@H]2OC(C)=O)[C@H]1O |
| InChI | InChI=1S/C35H60O13/c1-9-11-13-14-15-17-19-41-34-28(40)31(29(22(5)42-34)46-26(38)18-16-12-10-2)48-35-33(45-25(8)37)32(47-27(39)20-21(3)4)30(23(6)43-35)44-24(7)36/h21-23,28-35,40H,9-20H2,1-8H3/t22-,23-,28+,29-,30-,31-,32+,33+,34+,35-/m0/s1 |
| InChIKey | CPHOXAYOVGIKKU-ZIGAZZGJSA-N |
| XLogP | 4.91 |
| TPSA | 162.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.85 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|