C22H16N4O3 — CID 122181026
4-[[2-methyl-3-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]indol-1-yl]methyl]benzonitrile (PubChem CID 122181026) has the molecular formula C22H16N4O3 and a molecular weight of 384.40 g/mol. Its IUPAC name is 4-[[2-methyl-3-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]indol-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[2-methyl-3-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]indol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 122181026 |
| Molecular Formula | C22H16N4O3 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 4-[[2-methyl-3-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]indol-1-yl]methyl]benzonitrile |
| SMILES | Cc1c(C=C2C(=O)NC(=O)NC2=O)c2ccccc2n1Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C22H16N4O3/c1-13-17(10-18-20(27)24-22(29)25-21(18)28)16-4-2-3-5-19(16)26(13)12-15-8-6-14(11-23)7-9-15/h2-10H,12H2,1H3,(H2,24,25,27,28,29) |
| InChIKey | JSDSQBVKQABPAN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|