C20H30FNO2 — CID 122181072
(1R,2R,5S)-5-(3-fluoropropoxy)-2-(4-phenylpiperidin-1-yl)cyclohexan-1-ol (PubChem CID 122181072) has the molecular formula C20H30FNO2 and a molecular weight of 335.46 g/mol. Its IUPAC name is (1R,2R,5S)-5-(3-fluoropropoxy)-2-(4-phenylpiperidin-1-yl)cyclohexan-1-ol.
| Compound Name | (1R,2R,5S)-5-(3-fluoropropoxy)-2-(4-phenylpiperidin-1-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 122181072 |
| Molecular Formula | C20H30FNO2 |
| Molecular Weight | 335.46 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | (1R,2R,5S)-5-(3-fluoropropoxy)-2-(4-phenylpiperidin-1-yl)cyclohexan-1-ol |
| SMILES | O[C@@H]1C[C@@H](OCCCF)CC[C@H]1N1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H30FNO2/c21-11-4-14-24-18-7-8-19(20(23)15-18)22-12-9-17(10-13-22)16-5-2-1-3-6-16/h1-3,5-6,17-20,23H,4,7-15H2/t18-,19+,20+/m0/s1 |
| InChIKey | KRYVMGGFGDVMQS-XUVXKRRUSA-N |
| XLogP | 3.52 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|