About trans-(1R,2R)-2-(4,4-diphenylpiperidin-1-yl)cyclohexan-1-ol
trans-(1R,2R)-2-(4,4-diphenylpiperidin-1-yl)cyclohexan-1-ol (PubChem CID 122181169) has the molecular formula C23H29NO
and a molecular weight of 335.49 g/mol. Its IUPAC name is trans-(1R,2R)-2-(4,4-diphenylpiperidin-1-yl)cyclohexan-1-ol.
Molecular Properties
| Compound Name | trans-(1R,2R)-2-(4,4-diphenylpiperidin-1-yl)cyclohexan-1-ol |
| PubChem CID | 122181169 |
| Molecular Formula | C23H29NO |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | trans-(1R,2R)-2-(4,4-diphenylpiperidin-1-yl)cyclohexan-1-ol |
| SMILES | O[C@@H]1CCCC[C@H]1N1CCC(c2ccccc2)(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H29NO/c25-22-14-8-7-13-21(22)24-17-15-23(16-18-24,19-9-3-1-4-10-19)20-11-5-2-6-12-20/h1-6,9-12,21-22,25H,7-8,13-18H2/t21-,22-/m1/s1 |
| InChIKey | FTZBYQIFOKIEAG-FGZHOGPDSA-N |
| XLogP | 4.37 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze trans-(1R,2R)-2-(4,4-diphenylpiperidin-1-yl)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-2-(4,4-diphenylpiperidin-1-yl)cyclohexan-1-ol?
The IUPAC name of trans-(1R,2R)-2-(4,4-diphenylpiperidin-1-yl)cyclohexan-1-ol (CID 122181169) is trans-(1R,2R)-2-(4,4-diphenylpiperidin-1-yl)cyclohexan-1-ol.
What is the SMILES notation for trans-(1R,2R)-2-(4,4-diphenylpiperidin-1-yl)cyclohexan-1-ol?
The canonical SMILES for trans-(1R,2R)-2-(4,4-diphenylpiperidin-1-yl)cyclohexan-1-ol is O[C@@H]1CCCC[C@H]1N1CCC(c2ccccc2)(c2ccccc2)CC1.
What is the InChIKey of trans-(1R,2R)-2-(4,4-diphenylpiperidin-1-yl)cyclohexan-1-ol?
The InChIKey is FTZBYQIFOKIEAG-FGZHOGPDSA-N. The full InChI is InChI=1S/C23H29NO/c25-22-14-8-7-13-21(22)24-17-15-23(16-18-24,19-9-3-1-4-10-19)20-11-5-2-6-12-20/h1-6,9-12,21-22,25H,7-8,13-18H2/t21-,22-/m1/s1.
What are the key properties of trans-(1R,2R)-2-(4,4-diphenylpiperidin-1-yl)cyclohexan-1-ol?
trans-(1R,2R)-2-(4,4-diphenylpiperidin-1-yl)cyclohexan-1-ol has a molecular weight of 335.49 g/mol, XLogP of 4.37, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-2-(4,4-diphenylpiperidin-1-yl)cyclohexan-1-ol is sourced from PubChem (CID 122181169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).