C23H23Cl2F4N7O2 — CID 122181241
2-amino-4-[2,4-dichloro-6-[2-(4-fluoropyrazol-1-yl)ethoxy]phenyl]-N-(4,4,4-trifluoro-2-methylbutan-2-yl)-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxamide (PubChem CID 122181241) has the molecular formula C23H23Cl2F4N7O2 and a molecular weight of 576.38 g/mol. Its IUPAC name is 2-amino-4-[2,4-dichloro-6-[2-(4-fluoropyrazol-1-yl)ethoxy]phenyl]-N-(4,4,4-trifluoro-2-methylbutan-2-yl)-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxamide.
| Compound Name | 2-amino-4-[2,4-dichloro-6-[2-(4-fluoropyrazol-1-yl)ethoxy]phenyl]-N-(4,4,4-trifluoro-2-methylbutan-2-yl)-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 122181241 |
| Molecular Formula | C23H23Cl2F4N7O2 |
| Molecular Weight | 576.38 g/mol |
| Exact Mass | 575.12 |
| IUPAC Name | 2-amino-4-[2,4-dichloro-6-[2-(4-fluoropyrazol-1-yl)ethoxy]phenyl]-N-(4,4,4-trifluoro-2-methylbutan-2-yl)-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxamide |
| SMILES | CC(C)(CC(F)(F)F)NC(=O)N1Cc2nc(N)nc(-c3c(Cl)cc(Cl)cc3OCCn3cc(F)cn3)c2C1 |
| InChI | InChI=1S/C23H23Cl2F4N7O2/c1-22(2,11-23(27,28)29)34-21(37)35-9-14-16(10-35)32-20(30)33-19(14)18-15(25)5-12(24)6-17(18)38-4-3-36-8-13(26)7-31-36/h5-8H,3-4,9-11H2,1-2H3,(H,34,37)(H2,30,32,33) |
| InChIKey | QBVULPBOAPRXKU-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.38 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |